C11H12O6 — CID 171877541
4-(5-formyl-2-hydroxyphenyl)-3,4-dihydroxybutanoic acid (PubChem CID 171877541) has the molecular formula C11H12O6 and a molecular weight of 240.21 g/mol. Its IUPAC name is 4-(5-formyl-2-hydroxyphenyl)-3,4-dihydroxybutanoic acid.
| Compound Name | 4-(5-formyl-2-hydroxyphenyl)-3,4-dihydroxybutanoic acid |
|---|---|
| PubChem CID | 171877541 |
| Molecular Formula | C11H12O6 |
| Molecular Weight | 240.21 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 4-(5-formyl-2-hydroxyphenyl)-3,4-dihydroxybutanoic acid |
| SMILES | O=Cc1ccc(O)c(C(O)C(O)CC(=O)O)c1 |
| InChI | InChI=1S/C11H12O6/c12-5-6-1-2-8(13)7(3-6)11(17)9(14)4-10(15)16/h1-3,5,9,11,13-14,17H,4H2,(H,15,16) |
| InChIKey | FEQWHRWFCGJUCF-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.21 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|