C10H12FNO4 — CID 171898776
4-(5-fluoro-2-hydroxyphenyl)-3,4-dihydroxybutanamide (PubChem CID 171898776) has the molecular formula C10H12FNO4 and a molecular weight of 229.21 g/mol. Its IUPAC name is 4-(5-fluoro-2-hydroxyphenyl)-3,4-dihydroxybutanamide.
| Compound Name | 4-(5-fluoro-2-hydroxyphenyl)-3,4-dihydroxybutanamide |
|---|---|
| PubChem CID | 171898776 |
| Molecular Formula | C10H12FNO4 |
| Molecular Weight | 229.21 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | 4-(5-fluoro-2-hydroxyphenyl)-3,4-dihydroxybutanamide |
| SMILES | NC(=O)CC(O)C(O)c1cc(F)ccc1O |
| InChI | InChI=1S/C10H12FNO4/c11-5-1-2-7(13)6(3-5)10(16)8(14)4-9(12)15/h1-3,8,10,13-14,16H,4H2,(H2,12,15) |
| InChIKey | APXMWBKJXFOOGX-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.21 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |