C11H12N2O4 — CID 171899303
4-(5-cyano-2-hydroxyphenyl)-3,4-dihydroxybutanamide (PubChem CID 171899303) has the molecular formula C11H12N2O4 and a molecular weight of 236.23 g/mol. Its IUPAC name is 4-(5-cyano-2-hydroxyphenyl)-3,4-dihydroxybutanamide.
| Compound Name | 4-(5-cyano-2-hydroxyphenyl)-3,4-dihydroxybutanamide |
|---|---|
| PubChem CID | 171899303 |
| Molecular Formula | C11H12N2O4 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 4-(5-cyano-2-hydroxyphenyl)-3,4-dihydroxybutanamide |
| SMILES | N#Cc1ccc(O)c(C(O)C(O)CC(N)=O)c1 |
| InChI | InChI=1S/C11H12N2O4/c12-5-6-1-2-8(14)7(3-6)11(17)9(15)4-10(13)16/h1-3,9,11,14-15,17H,4H2,(H2,13,16) |
| InChIKey | IWTQMJLPIIJVLI-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 127.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |