C12H13FN2O3 — CID 171899586
4-[5-(cyanomethyl)-2-fluorophenyl]-3,4-dihydroxybutanamide (PubChem CID 171899586) has the molecular formula C12H13FN2O3 and a molecular weight of 252.24 g/mol. Its IUPAC name is 4-[5-(cyanomethyl)-2-fluorophenyl]-3,4-dihydroxybutanamide.
| Compound Name | 4-[5-(cyanomethyl)-2-fluorophenyl]-3,4-dihydroxybutanamide |
|---|---|
| PubChem CID | 171899586 |
| Molecular Formula | C12H13FN2O3 |
| Molecular Weight | 252.24 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 4-[5-(cyanomethyl)-2-fluorophenyl]-3,4-dihydroxybutanamide |
| SMILES | N#CCc1ccc(F)c(C(O)C(O)CC(N)=O)c1 |
| InChI | InChI=1S/C12H13FN2O3/c13-9-2-1-7(3-4-14)5-8(9)12(18)10(16)6-11(15)17/h1-2,5,10,12,16,18H,3,6H2,(H2,15,17) |
| InChIKey | ONSWGWMTZQDJSO-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 107.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.24 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |