C10H11N3O3 — CID 171898842
4-(5-cyano-2-pyridinyl)-3,4-dihydroxybutanamide (PubChem CID 171898842) has the molecular formula C10H11N3O3 and a molecular weight of 221.22 g/mol. Its IUPAC name is 4-(5-cyano-2-pyridinyl)-3,4-dihydroxybutanamide.
| Compound Name | 4-(5-cyano-2-pyridinyl)-3,4-dihydroxybutanamide |
|---|---|
| PubChem CID | 171898842 |
| Molecular Formula | C10H11N3O3 |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | 4-(5-cyano-2-pyridinyl)-3,4-dihydroxybutanamide |
| SMILES | N#Cc1ccc(C(O)C(O)CC(N)=O)nc1 |
| InChI | InChI=1S/C10H11N3O3/c11-4-6-1-2-7(13-5-6)10(16)8(14)3-9(12)15/h1-2,5,8,10,14,16H,3H2,(H2,12,15) |
| InChIKey | VIXGLFFMSKHWPQ-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 120.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |