C9H11N3O5 — CID 171899165
3,4-dihydroxy-4-(5-nitro-2-pyridinyl)butanamide (PubChem CID 171899165) has the molecular formula C9H11N3O5 and a molecular weight of 241.20 g/mol. Its IUPAC name is 3,4-dihydroxy-4-(5-nitro-2-pyridinyl)butanamide.
| Compound Name | 3,4-dihydroxy-4-(5-nitro-2-pyridinyl)butanamide |
|---|---|
| PubChem CID | 171899165 |
| Molecular Formula | C9H11N3O5 |
| Molecular Weight | 241.20 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 3,4-dihydroxy-4-(5-nitro-2-pyridinyl)butanamide |
| SMILES | NC(=O)CC(O)C(O)c1ccc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C9H11N3O5/c10-8(14)3-7(13)9(15)6-2-1-5(4-11-6)12(16)17/h1-2,4,7,9,13,15H,3H2,(H2,10,14) |
| InChIKey | FHMGHZKEXMSJSV-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 139.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.20 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|