C11H14N2O4 — CID 118156200
3,3-dimethyl-2-(5-nitro-2-pyridinyl)butanoic acid (PubChem CID 118156200) has the molecular formula C11H14N2O4 and a molecular weight of 238.24 g/mol. Its IUPAC name is 3,3-dimethyl-2-(5-nitro-2-pyridinyl)butanoic acid.
| Compound Name | 3,3-dimethyl-2-(5-nitro-2-pyridinyl)butanoic acid |
|---|---|
| PubChem CID | 118156200 |
| Molecular Formula | C11H14N2O4 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 3,3-dimethyl-2-(5-nitro-2-pyridinyl)butanoic acid |
| SMILES | CC(C)(C)C(C(=O)O)c1ccc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C11H14N2O4/c1-11(2,3)9(10(14)15)8-5-4-7(6-12-8)13(16)17/h4-6,9H,1-3H3,(H,14,15) |
| InChIKey | JDUGYONFOMBNKN-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 93.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|