C16H14BrN5O2 — CID 158463192
6-(2-amino-1-hydroxyethyl)pyridine-3-carbonitrile;6-(2-bromoacetyl)pyridine-3-carbonitrile (PubChem CID 158463192) has the molecular formula C16H14BrN5O2 and a molecular weight of 388.23 g/mol. Its IUPAC name is 6-(2-amino-1-hydroxyethyl)pyridine-3-carbonitrile;6-(2-bromoacetyl)pyridine-3-carbonitrile.
| Compound Name | 6-(2-amino-1-hydroxyethyl)pyridine-3-carbonitrile;6-(2-bromoacetyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 158463192 |
| Molecular Formula | C16H14BrN5O2 |
| Molecular Weight | 388.23 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | 6-(2-amino-1-hydroxyethyl)pyridine-3-carbonitrile;6-(2-bromoacetyl)pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(C(=O)CBr)nc1.N#Cc1ccc(C(O)CN)nc1 |
| InChI | InChI=1S/C8H5BrN2O.C8H9N3O/c9-3-8(12)7-2-1-6(4-10)5-11-7;9-3-6-1-2-7(11-5-6)8(12)4-10/h1-2,5H,3H2;1-2,5,8,12H,4,10H2 |
| InChIKey | HFKYUSOACIFJHH-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.23 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|