C13H14ClNO3S — CID 170821236
1-(2-chloro-6-methoxyquinolin-3-yl)-3-sulfanylpropane-1,2-diol (PubChem CID 170821236) has the molecular formula C13H14ClNO3S and a molecular weight of 299.78 g/mol. Its IUPAC name is 1-(2-chloro-6-methoxyquinolin-3-yl)-3-sulfanylpropane-1,2-diol.
| Compound Name | 1-(2-chloro-6-methoxyquinolin-3-yl)-3-sulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 170821236 |
| Molecular Formula | C13H14ClNO3S |
| Molecular Weight | 299.78 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 1-(2-chloro-6-methoxyquinolin-3-yl)-3-sulfanylpropane-1,2-diol |
| SMILES | COc1ccc2nc(Cl)c(C(O)C(O)CS)cc2c1 |
| InChI | InChI=1S/C13H14ClNO3S/c1-18-8-2-3-10-7(4-8)5-9(13(14)15-10)12(17)11(16)6-19/h2-5,11-12,16-17,19H,6H2,1H3 |
| InChIKey | ZDJTUODLDJVONH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.78 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|