C14H16ClNO3 — CID 10265756
(1S,3S)-1-(2-chloro-7-methoxyquinolin-3-yl)butane-1,3-diol (PubChem CID 10265756) has the molecular formula C14H16ClNO3 and a molecular weight of 281.74 g/mol. Its IUPAC name is (1S,3S)-1-(2-chloro-7-methoxyquinolin-3-yl)butane-1,3-diol.
| Compound Name | (1S,3S)-1-(2-chloro-7-methoxyquinolin-3-yl)butane-1,3-diol |
|---|---|
| PubChem CID | 10265756 |
| Molecular Formula | C14H16ClNO3 |
| Molecular Weight | 281.74 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | (1S,3S)-1-(2-chloro-7-methoxyquinolin-3-yl)butane-1,3-diol |
| SMILES | COc1ccc2cc([C@@H](O)C[C@H](C)O)c(Cl)nc2c1 |
| InChI | InChI=1S/C14H16ClNO3/c1-8(17)5-13(18)11-6-9-3-4-10(19-2)7-12(9)16-14(11)15/h3-4,6-8,13,17-18H,5H2,1-2H3/t8-,13-/m0/s1 |
| InChIKey | KOKAVCCRJXHHHP-SDBXPKJASA-N |
| XLogP | 2.70 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.74 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|