C12H16O5S — CID 171874693
2-(1,2-dihydroxy-4-sulfanylbutyl)-3-hydroxy-4-methoxybenzaldehyde (PubChem CID 171874693) has the molecular formula C12H16O5S and a molecular weight of 272.32 g/mol. Its IUPAC name is 2-(1,2-dihydroxy-4-sulfanylbutyl)-3-hydroxy-4-methoxybenzaldehyde.
| Compound Name | 2-(1,2-dihydroxy-4-sulfanylbutyl)-3-hydroxy-4-methoxybenzaldehyde |
|---|---|
| PubChem CID | 171874693 |
| Molecular Formula | C12H16O5S |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 2-(1,2-dihydroxy-4-sulfanylbutyl)-3-hydroxy-4-methoxybenzaldehyde |
| SMILES | COc1ccc(C=O)c(C(O)C(O)CCS)c1O |
| InChI | InChI=1S/C12H16O5S/c1-17-9-3-2-7(6-13)10(12(9)16)11(15)8(14)4-5-18/h2-3,6,8,11,14-16,18H,4-5H2,1H3 |
| InChIKey | DXQSPQYAOKVZPC-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|