C10H10Br3FO2 — CID 171893126
4-bromo-1-(2,6-dibromo-4-fluorophenyl)butane-1,2-diol (PubChem CID 171893126) has the molecular formula C10H10Br3FO2 and a molecular weight of 420.90 g/mol. Its IUPAC name is 4-bromo-1-(2,6-dibromo-4-fluorophenyl)butane-1,2-diol.
| Compound Name | 4-bromo-1-(2,6-dibromo-4-fluorophenyl)butane-1,2-diol |
|---|---|
| PubChem CID | 171893126 |
| Molecular Formula | C10H10Br3FO2 |
| Molecular Weight | 420.90 g/mol |
| Exact Mass | 417.82 |
| IUPAC Name | 4-bromo-1-(2,6-dibromo-4-fluorophenyl)butane-1,2-diol |
| SMILES | OC(CCBr)C(O)c1c(Br)cc(F)cc1Br |
| InChI | InChI=1S/C10H10Br3FO2/c11-2-1-8(15)10(16)9-6(12)3-5(14)4-7(9)13/h3-4,8,10,15-16H,1-2H2 |
| InChIKey | ZWGTUWKCMOCLSZ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.90 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|