C12H16O3S2 — CID 170821473
S-[2,3-dihydroxy-3-(3-methylsulfanylphenyl)propyl] ethanethioate (PubChem CID 170821473) has the molecular formula C12H16O3S2 and a molecular weight of 272.39 g/mol. Its IUPAC name is S-[2,3-dihydroxy-3-(3-methylsulfanylphenyl)propyl] ethanethioate.
| Compound Name | S-[2,3-dihydroxy-3-(3-methylsulfanylphenyl)propyl] ethanethioate |
|---|---|
| PubChem CID | 170821473 |
| Molecular Formula | C12H16O3S2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | S-[2,3-dihydroxy-3-(3-methylsulfanylphenyl)propyl] ethanethioate |
| SMILES | CSc1cccc(C(O)C(O)CSC(C)=O)c1 |
| InChI | InChI=1S/C12H16O3S2/c1-8(13)17-7-11(14)12(15)9-4-3-5-10(6-9)16-2/h3-6,11-12,14-15H,7H2,1-2H3 |
| InChIKey | GXHAYGDKVWBDCV-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|