C10H10Cl2O4 — CID 170823809
3-[4-chloro-3-(chloromethyl)phenyl]-2,3-dihydroxypropanoic acid (PubChem CID 170823809) has the molecular formula C10H10Cl2O4 and a molecular weight of 265.09 g/mol. Its IUPAC name is 3-[4-chloro-3-(chloromethyl)phenyl]-2,3-dihydroxypropanoic acid.
| Compound Name | 3-[4-chloro-3-(chloromethyl)phenyl]-2,3-dihydroxypropanoic acid |
|---|---|
| PubChem CID | 170823809 |
| Molecular Formula | C10H10Cl2O4 |
| Molecular Weight | 265.09 g/mol |
| Exact Mass | 264.00 |
| IUPAC Name | 3-[4-chloro-3-(chloromethyl)phenyl]-2,3-dihydroxypropanoic acid |
| SMILES | O=C(O)C(O)C(O)c1ccc(Cl)c(CCl)c1 |
| InChI | InChI=1S/C10H10Cl2O4/c11-4-6-3-5(1-2-7(6)12)8(13)9(14)10(15)16/h1-3,8-9,13-14H,4H2,(H,15,16) |
| InChIKey | FJMBDKOEIASCBA-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.09 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|