C11H11ClO5 — CID 170824284
3-(4-acetyl-3-chlorophenyl)-2,3-dihydroxypropanoic acid (PubChem CID 170824284) has the molecular formula C11H11ClO5 and a molecular weight of 258.66 g/mol. Its IUPAC name is 3-(4-acetyl-3-chlorophenyl)-2,3-dihydroxypropanoic acid.
| Compound Name | 3-(4-acetyl-3-chlorophenyl)-2,3-dihydroxypropanoic acid |
|---|---|
| PubChem CID | 170824284 |
| Molecular Formula | C11H11ClO5 |
| Molecular Weight | 258.66 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | 3-(4-acetyl-3-chlorophenyl)-2,3-dihydroxypropanoic acid |
| SMILES | CC(=O)c1ccc(C(O)C(O)C(=O)O)cc1Cl |
| InChI | InChI=1S/C11H11ClO5/c1-5(13)7-3-2-6(4-8(7)12)9(14)10(15)11(16)17/h2-4,9-10,14-15H,1H3,(H,16,17) |
| InChIKey | OOSSLMLWPSKKEQ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.66 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |