C10H10ClFO3 — CID 101434989
(3R,4S)-4-(3-chloro-4-fluorophenyl)-3,4-dihydroxybutan-2-one (PubChem CID 101434989) has the molecular formula C10H10ClFO3 and a molecular weight of 232.64 g/mol. Its IUPAC name is (3R,4S)-4-(3-chloro-4-fluorophenyl)-3,4-dihydroxybutan-2-one.
| Compound Name | (3R,4S)-4-(3-chloro-4-fluorophenyl)-3,4-dihydroxybutan-2-one |
|---|---|
| PubChem CID | 101434989 |
| Molecular Formula | C10H10ClFO3 |
| Molecular Weight | 232.64 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | (3R,4S)-4-(3-chloro-4-fluorophenyl)-3,4-dihydroxybutan-2-one |
| SMILES | CC(=O)[C@H](O)[C@@H](O)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C10H10ClFO3/c1-5(13)9(14)10(15)6-2-3-8(12)7(11)4-6/h2-4,9-10,14-15H,1H3/t9-,10-/m0/s1 |
| InChIKey | MYURAPGNTRBCKL-UWVGGRQHSA-N |
| XLogP | 1.46 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.64 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |