C17H24O6S — CID 56589442
[3-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-hydroxy-5-methoxyphenyl] hydrogen sulfate (PubChem CID 56589442) has the molecular formula C17H24O6S and a molecular weight of 356.44 g/mol. Its IUPAC name is [3-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-hydroxy-5-methoxyphenyl] hydrogen sulfate.
| Compound Name | [3-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-hydroxy-5-methoxyphenyl] hydrogen sulfate |
|---|---|
| PubChem CID | 56589442 |
| Molecular Formula | C17H24O6S |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | [3-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-hydroxy-5-methoxyphenyl] hydrogen sulfate |
| SMILES | COc1cc(OS(=O)(=O)O)cc(C/C=C(\C)CCC=C(C)C)c1O |
| InChI | InChI=1S/C17H24O6S/c1-12(2)6-5-7-13(3)8-9-14-10-15(23-24(19,20)21)11-16(22-4)17(14)18/h6,8,10-11,18H,5,7,9H2,1-4H3,(H,19,20,21)/b13-8+ |
| InChIKey | DRAYHHJKKGGZRK-MDWZMJQESA-N |
| XLogP | 3.82 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|