C46H70O5S — CID 10078671
[4-hydroxy-3-[(2E,6E,10E,14E,18E,22E,26E)-3,7,11,15,19,23,27,31-octamethyldotriaconta-2,6,10,14,18,22,26,30-octaenyl]phenyl] hydrogen sulfate (PubChem CID 10078671) has the molecular formula C46H70O5S and a molecular weight of 735.13 g/mol. Its IUPAC name is [4-hydroxy-3-[(2E,6E,10E,14E,18E,22E,26E)-3,7,11,15,19,23,27,31-octamethyldotriaconta-2,6,10,14,18,22,26,30-octaenyl]phenyl] hydrogen sulfate.
| Compound Name | [4-hydroxy-3-[(2E,6E,10E,14E,18E,22E,26E)-3,7,11,15,19,23,27,31-octamethyldotriaconta-2,6,10,14,18,22,26,30-octaenyl]phenyl] hydrogen sulfate |
|---|---|
| PubChem CID | 10078671 |
| Molecular Formula | C46H70O5S |
| Molecular Weight | 735.13 g/mol |
| Exact Mass | 734.49 |
| IUPAC Name | [4-hydroxy-3-[(2E,6E,10E,14E,18E,22E,26E)-3,7,11,15,19,23,27,31-octamethyldotriaconta-2,6,10,14,18,22,26,30-octaenyl]phenyl] hydrogen sulfate |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/Cc1cc(OS(=O)(=O)O)ccc1O |
| InChI | InChI=1S/C46H70O5S/c1-36(2)17-10-18-37(3)19-11-20-38(4)21-12-22-39(5)23-13-24-40(6)25-14-26-41(7)27-15-28-42(8)29-16-30-43(9)31-32-44-35-45(33-34-46(44)47)51-52(48,49)50/h17,19,21,23,25,27,29,31,33-35,47H,10-16,18,20,22,24,26,28,30,32H2,1-9H3,(H,48,49,50)/b37-19+,38-21+,39-23+,40-25+,41-27+,42-29+,43-31+ |
| InChIKey | RLOMLFQLRDXNKE-LQOKPSQISA-N |
| XLogP | 14.17 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.13 |
| LogP ≤ 5 | 14.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|