C16H20O3 — CID 11747343
(2E,6E)-8-(2,5-dihydroxyphenyl)-2,6-dimethylocta-2,6-dienal (PubChem CID 11747343) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is (2E,6E)-8-(2,5-dihydroxyphenyl)-2,6-dimethylocta-2,6-dienal.
| Compound Name | (2E,6E)-8-(2,5-dihydroxyphenyl)-2,6-dimethylocta-2,6-dienal |
|---|---|
| PubChem CID | 11747343 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | (2E,6E)-8-(2,5-dihydroxyphenyl)-2,6-dimethylocta-2,6-dienal |
| SMILES | C/C(C=O)=C\CC/C(C)=C/Cc1cc(O)ccc1O |
| InChI | InChI=1S/C16H20O3/c1-12(4-3-5-13(2)11-17)6-7-14-10-15(18)8-9-16(14)19/h5-6,8-11,18-19H,3-4,7H2,1-2H3/b12-6+,13-5+ |
| InChIKey | SMWFREPIBWIJGX-YKNDAMCPSA-N |
| XLogP | 3.51 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|