C20H24O2 — CID 134912179
3-[(2E)-3,7-dimethylocta-2,6-dienyl]-7-methylchromen-2-one (PubChem CID 134912179) has the molecular formula C20H24O2 and a molecular weight of 296.41 g/mol. Its IUPAC name is 3-[(2E)-3,7-dimethylocta-2,6-dienyl]-7-methylchromen-2-one.
| Compound Name | 3-[(2E)-3,7-dimethylocta-2,6-dienyl]-7-methylchromen-2-one |
|---|---|
| PubChem CID | 134912179 |
| Molecular Formula | C20H24O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 3-[(2E)-3,7-dimethylocta-2,6-dienyl]-7-methylchromen-2-one |
| SMILES | CC(C)=CCC/C(C)=C/Cc1cc2ccc(C)cc2oc1=O |
| InChI | InChI=1S/C20H24O2/c1-14(2)6-5-7-15(3)8-11-18-13-17-10-9-16(4)12-19(17)22-20(18)21/h6,8-10,12-13H,5,7,11H2,1-4H3/b15-8+ |
| InChIKey | BLNRFHWWSYUWJK-OVCLIPMQSA-N |
| XLogP | 5.34 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|