C14H13O3- — CID 102525261
8-(3-methylbut-2-enyl)-2-oxochromen-7-olate (PubChem CID 102525261) has the molecular formula C14H13O3- and a molecular weight of 229.25 g/mol. Its IUPAC name is 8-(3-methylbut-2-enyl)-2-oxochromen-7-olate.
| Compound Name | 8-(3-methylbut-2-enyl)-2-oxochromen-7-olate |
|---|---|
| PubChem CID | 102525261 |
| Molecular Formula | C14H13O3- |
| Molecular Weight | 229.25 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 8-(3-methylbut-2-enyl)-2-oxochromen-7-olate |
| SMILES | CC(C)=CCc1c([O-])ccc2ccc(=O)oc12 |
| InChI | InChI=1S/C14H14O3/c1-9(2)3-6-11-12(15)7-4-10-5-8-13(16)17-14(10)11/h3-5,7-8,15H,6H2,1-2H3/p-1 |
| InChIKey | RAKJVIPCCGXHHS-UHFFFAOYSA-M |
| XLogP | 2.38 |
| TPSA | 53.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.25 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|