C25H27N3O5 — CID 162660740
2-[8-(3-methylbut-2-enyl)-2-oxochromen-7-yl]oxy-N-(5-morpholin-4-yl-2-pyridinyl)acetamide (PubChem CID 162660740) has the molecular formula C25H27N3O5 and a molecular weight of 449.51 g/mol. Its IUPAC name is 2-[8-(3-methylbut-2-enyl)-2-oxochromen-7-yl]oxy-N-(5-morpholin-4-yl-2-pyridinyl)acetamide.
| Compound Name | 2-[8-(3-methylbut-2-enyl)-2-oxochromen-7-yl]oxy-N-(5-morpholin-4-yl-2-pyridinyl)acetamide |
|---|---|
| PubChem CID | 162660740 |
| Molecular Formula | C25H27N3O5 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | 2-[8-(3-methylbut-2-enyl)-2-oxochromen-7-yl]oxy-N-(5-morpholin-4-yl-2-pyridinyl)acetamide |
| SMILES | CC(C)=CCc1c(OCC(=O)Nc2ccc(N3CCOCC3)cn2)ccc2ccc(=O)oc12 |
| InChI | InChI=1S/C25H27N3O5/c1-17(2)3-7-20-21(8-4-18-5-10-24(30)33-25(18)20)32-16-23(29)27-22-9-6-19(15-26-22)28-11-13-31-14-12-28/h3-6,8-10,15H,7,11-14,16H2,1-2H3,(H,26,27,29) |
| InChIKey | GLIWEOKTEANRCP-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 93.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|