C25H24O6 — CID 102358407
2-propan-2-yl-3-[(Z)-2-(2,3,4-trimethoxyphenyl)ethenyl]furo[3,2-g]chromen-7-one (PubChem CID 102358407) has the molecular formula C25H24O6 and a molecular weight of 420.46 g/mol. Its IUPAC name is 2-propan-2-yl-3-[(Z)-2-(2,3,4-trimethoxyphenyl)ethenyl]furo[3,2-g]chromen-7-one.
| Compound Name | 2-propan-2-yl-3-[(Z)-2-(2,3,4-trimethoxyphenyl)ethenyl]furo[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 102358407 |
| Molecular Formula | C25H24O6 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 2-propan-2-yl-3-[(Z)-2-(2,3,4-trimethoxyphenyl)ethenyl]furo[3,2-g]chromen-7-one |
| SMILES | COc1ccc(/C=C\c2c(C(C)C)oc3cc4oc(=O)ccc4cc23)c(OC)c1OC |
| InChI | InChI=1S/C25H24O6/c1-14(2)23-17(9-6-15-7-10-19(27-3)25(29-5)24(15)28-4)18-12-16-8-11-22(26)30-20(16)13-21(18)31-23/h6-14H,1-5H3/b9-6- |
| InChIKey | WRPMTPKRYBTTQE-TWGQIWQCSA-N |
| XLogP | 5.86 |
| TPSA | 71.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|