C11H9BrO4 — CID 67762458
3-bromo-6,7-dimethoxychromen-4-one (PubChem CID 67762458) has the molecular formula C11H9BrO4 and a molecular weight of 285.09 g/mol. Its IUPAC name is 3-bromo-6,7-dimethoxychromen-4-one.
| Compound Name | 3-bromo-6,7-dimethoxychromen-4-one |
|---|---|
| PubChem CID | 67762458 |
| Molecular Formula | C11H9BrO4 |
| Molecular Weight | 285.09 g/mol |
| Exact Mass | 283.97 |
| IUPAC Name | 3-bromo-6,7-dimethoxychromen-4-one |
| SMILES | COc1cc2occ(Br)c(=O)c2cc1OC |
| InChI | InChI=1S/C11H9BrO4/c1-14-9-3-6-8(4-10(9)15-2)16-5-7(12)11(6)13/h3-5H,1-2H3 |
| InChIKey | XGMXUGXHWMSTKY-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.09 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |