About 7-hydroxychromen-2-one;methyl dihydrogen phosphate
7-hydroxychromen-2-one;methyl dihydrogen phosphate (PubChem CID 87123175) has the molecular formula C10H11O7P
and a molecular weight of 274.17 g/mol. Its IUPAC name is 7-hydroxychromen-2-one;methyl dihydrogen phosphate.
Molecular Properties
| Compound Name | 7-hydroxychromen-2-one;methyl dihydrogen phosphate |
| PubChem CID | 87123175 |
| Molecular Formula | C10H11O7P |
| Molecular Weight | 274.17 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 7-hydroxychromen-2-one;methyl dihydrogen phosphate |
| SMILES | COP(=O)(O)O.O=c1ccc2ccc(O)cc2o1 |
| InChI | InChI=1S/C9H6O3.CH5O4P/c10-7-3-1-6-2-4-9(11)12-8(6)5-7;1-5-6(2,3)4/h1-5,10H;1H3,(H2,2,3,4) |
| InChIKey | SKWUILWLYCYYSX-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.17 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 7-hydroxychromen-2-one;methyl dihydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-hydroxychromen-2-one;methyl dihydrogen phosphate?
The IUPAC name of 7-hydroxychromen-2-one;methyl dihydrogen phosphate (CID 87123175) is 7-hydroxychromen-2-one;methyl dihydrogen phosphate.
What is the SMILES notation for 7-hydroxychromen-2-one;methyl dihydrogen phosphate?
The canonical SMILES for 7-hydroxychromen-2-one;methyl dihydrogen phosphate is COP(=O)(O)O.O=c1ccc2ccc(O)cc2o1.
What is the InChIKey of 7-hydroxychromen-2-one;methyl dihydrogen phosphate?
The InChIKey is SKWUILWLYCYYSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6O3.CH5O4P/c10-7-3-1-6-2-4-9(11)12-8(6)5-7;1-5-6(2,3)4/h1-5,10H;1H3,(H2,2,3,4).
What are the key properties of 7-hydroxychromen-2-one;methyl dihydrogen phosphate?
7-hydroxychromen-2-one;methyl dihydrogen phosphate has a molecular weight of 274.17 g/mol, XLogP of 1.22, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-hydroxychromen-2-one;methyl dihydrogen phosphate is sourced from PubChem (CID 87123175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).