C12H16O4Se2 — CID 139038228
3,4-dimethoxyselenophene (PubChem CID 139038228) has the molecular formula C12H16O4Se2 and a molecular weight of 382.18 g/mol. Its IUPAC name is 3,4-dimethoxyselenophene.
| Compound Name | 3,4-dimethoxyselenophene |
|---|---|
| PubChem CID | 139038228 |
| Molecular Formula | C12H16O4Se2 |
| Molecular Weight | 382.18 g/mol |
| Exact Mass | 383.94 |
| IUPAC Name | 3,4-dimethoxyselenophene |
| SMILES | COc1c[se]cc1OC.COc1c[se]cc1OC |
| InChI | InChI=1S/2C6H8O2Se/c2*1-7-5-3-9-4-6(5)8-2/h2*3-4H,1-2H3 |
| InChIKey | DKDKVAMAMGHJLO-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.18 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|