C16H16O4Te2 — CID 139265067
2,3,7,8-tetramethoxytelluranthrene (PubChem CID 139265067) has the molecular formula C16H16O4Te2 and a molecular weight of 527.50 g/mol. Its IUPAC name is 2,3,7,8-tetramethoxytelluranthrene.
| Compound Name | 2,3,7,8-tetramethoxytelluranthrene |
|---|---|
| PubChem CID | 139265067 |
| Molecular Formula | C16H16O4Te2 |
| Molecular Weight | 527.50 g/mol |
| Exact Mass | 531.92 |
| IUPAC Name | 2,3,7,8-tetramethoxytelluranthrene |
| SMILES | COc1cc2c(cc1OC)[Te]c1cc(OC)c(OC)cc1[Te]2 |
| InChI | InChI=1S/C16H16O4Te2/c1-17-9-5-13-14(6-10(9)18-2)22-16-8-12(20-4)11(19-3)7-15(16)21-13/h5-8H,1-4H3 |
| InChIKey | BKRWXGNXDAOAQR-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.50 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|