C10H12O2 — CID 101034348
1,4-dimethoxy-3,6-dimethylidenecyclohexa-1,4-diene (PubChem CID 101034348) has the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is 1,4-dimethoxy-3,6-dimethylidenecyclohexa-1,4-diene.
| Compound Name | 1,4-dimethoxy-3,6-dimethylidenecyclohexa-1,4-diene |
|---|---|
| PubChem CID | 101034348 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 1,4-dimethoxy-3,6-dimethylidenecyclohexa-1,4-diene |
| SMILES | C=c1cc(OC)c(=C)cc1OC |
| InChI | InChI=1S/C10H12O2/c1-7-5-10(12-4)8(2)6-9(7)11-3/h5-6H,1-2H2,3-4H3 |
| InChIKey | IFLVWYRQVINFFV-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |