C16H16O4P2S4 — CID 139170767
2-(5,6-dimethoxy-1,3,2-benzodithiaphosphol-2-yl)-5,6-dimethoxy-1,3,2-benzodithiaphosphole (PubChem CID 139170767) has the molecular formula C16H16O4P2S4 and a molecular weight of 462.52 g/mol. Its IUPAC name is 2-(5,6-dimethoxy-1,3,2-benzodithiaphosphol-2-yl)-5,6-dimethoxy-1,3,2-benzodithiaphosphole.
| Compound Name | 2-(5,6-dimethoxy-1,3,2-benzodithiaphosphol-2-yl)-5,6-dimethoxy-1,3,2-benzodithiaphosphole |
|---|---|
| PubChem CID | 139170767 |
| Molecular Formula | C16H16O4P2S4 |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 461.94 |
| IUPAC Name | 2-(5,6-dimethoxy-1,3,2-benzodithiaphosphol-2-yl)-5,6-dimethoxy-1,3,2-benzodithiaphosphole |
| SMILES | COc1cc2c(cc1OC)SP(P1Sc3cc(OC)c(OC)cc3S1)S2 |
| InChI | InChI=1S/C16H16O4P2S4/c1-17-9-5-13-14(6-10(9)18-2)24-21(23-13)22-25-15-7-11(19-3)12(20-4)8-16(15)26-22/h5-8H,1-4H3 |
| InChIKey | FKFWJOSVYUKXNE-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|