C11H12O2S — CID 153240535
6,7-dimethoxy-4H-thiochromene (PubChem CID 153240535) has the molecular formula C11H12O2S and a molecular weight of 208.28 g/mol. Its IUPAC name is 6,7-dimethoxy-4H-thiochromene.
| Compound Name | 6,7-dimethoxy-4H-thiochromene |
|---|---|
| PubChem CID | 153240535 |
| Molecular Formula | C11H12O2S |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | 6,7-dimethoxy-4H-thiochromene |
| SMILES | COc1cc2c(cc1OC)SC=CC2 |
| InChI | InChI=1S/C11H12O2S/c1-12-9-6-8-4-3-5-14-11(8)7-10(9)13-2/h3,5-7H,4H2,1-2H3 |
| InChIKey | WRJARUNKXSCIHY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |