C13H19NO2 — CID 171088058
5,6-dimethoxy-2-methyl-1H-indole;ethane (PubChem CID 171088058) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 5,6-dimethoxy-2-methyl-1H-indole;ethane.
| Compound Name | 5,6-dimethoxy-2-methyl-1H-indole;ethane |
|---|---|
| PubChem CID | 171088058 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 5,6-dimethoxy-2-methyl-1H-indole;ethane |
| SMILES | CC.COc1cc2cc(C)[nH]c2cc1OC |
| InChI | InChI=1S/C11H13NO2.C2H6/c1-7-4-8-5-10(13-2)11(14-3)6-9(8)12-7;1-2/h4-6,12H,1-3H3;1-2H3 |
| InChIKey | YCOXSVLXPBGNTA-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |