C24H23N3O2 — CID 154840539
1'-(6,7,8,9-tetrahydro-5H-carbazole-1-carbonyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one (PubChem CID 154840539) has the molecular formula C24H23N3O2 and a molecular weight of 385.47 g/mol. Its IUPAC name is 1'-(6,7,8,9-tetrahydro-5H-carbazole-1-carbonyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one.
| Compound Name | 1'-(6,7,8,9-tetrahydro-5H-carbazole-1-carbonyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one |
|---|---|
| PubChem CID | 154840539 |
| Molecular Formula | C24H23N3O2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 1'-(6,7,8,9-tetrahydro-5H-carbazole-1-carbonyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one |
| SMILES | O=C(c1cccc2c3c([nH]c12)CCCC3)N1CCC2(C1)C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C24H23N3O2/c28-22(17-8-5-7-16-15-6-1-3-10-19(15)25-21(16)17)27-13-12-24(14-27)18-9-2-4-11-20(18)26-23(24)29/h2,4-5,7-9,11,25H,1,3,6,10,12-14H2,(H,26,29) |
| InChIKey | QMQFDSJOUDGKQH-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|