About (3S)-1'-(2-ethoxybenzoyl)spiro[1H-indole-3,3'-piperidine]-2-one
(3S)-1'-(2-ethoxybenzoyl)spiro[1H-indole-3,3'-piperidine]-2-one (PubChem CID 95718493) has the molecular formula C21H22N2O3
and a molecular weight of 350.42 g/mol. Its IUPAC name is (3S)-1'-(2-ethoxybenzoyl)spiro[1H-indole-3,3'-piperidine]-2-one.
Molecular Properties
| Compound Name | (3S)-1'-(2-ethoxybenzoyl)spiro[1H-indole-3,3'-piperidine]-2-one |
| PubChem CID | 95718493 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | (3S)-1'-(2-ethoxybenzoyl)spiro[1H-indole-3,3'-piperidine]-2-one |
| SMILES | CCOc1ccccc1C(=O)N1CCC[C@]2(C1)C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C21H22N2O3/c1-2-26-18-11-6-3-8-15(18)19(24)23-13-7-12-21(14-23)16-9-4-5-10-17(16)22-20(21)25/h3-6,8-11H,2,7,12-14H2,1H3,(H,22,25)/t21-/m1/s1 |
| InChIKey | ZNTATNJKWZNVCV-OAQYLSRUSA-N |
| XLogP | 3.21 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-1'-(2-ethoxybenzoyl)spiro[1H-indole-3,3'-piperidine]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1'-(2-ethoxybenzoyl)spiro[1H-indole-3,3'-piperidine]-2-one?
The IUPAC name of (3S)-1'-(2-ethoxybenzoyl)spiro[1H-indole-3,3'-piperidine]-2-one (CID 95718493) is (3S)-1'-(2-ethoxybenzoyl)spiro[1H-indole-3,3'-piperidine]-2-one.
What is the SMILES notation for (3S)-1'-(2-ethoxybenzoyl)spiro[1H-indole-3,3'-piperidine]-2-one?
The canonical SMILES for (3S)-1'-(2-ethoxybenzoyl)spiro[1H-indole-3,3'-piperidine]-2-one is CCOc1ccccc1C(=O)N1CCC[C@]2(C1)C(=O)Nc1ccccc12.
What is the InChIKey of (3S)-1'-(2-ethoxybenzoyl)spiro[1H-indole-3,3'-piperidine]-2-one?
The InChIKey is ZNTATNJKWZNVCV-OAQYLSRUSA-N. The full InChI is InChI=1S/C21H22N2O3/c1-2-26-18-11-6-3-8-15(18)19(24)23-13-7-12-21(14-23)16-9-4-5-10-17(16)22-20(21)25/h3-6,8-11H,2,7,12-14H2,1H3,(H,22,25)/t21-/m1/s1.
What are the key properties of (3S)-1'-(2-ethoxybenzoyl)spiro[1H-indole-3,3'-piperidine]-2-one?
(3S)-1'-(2-ethoxybenzoyl)spiro[1H-indole-3,3'-piperidine]-2-one has a molecular weight of 350.42 g/mol, XLogP of 3.21, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1'-(2-ethoxybenzoyl)spiro[1H-indole-3,3'-piperidine]-2-one is sourced from PubChem (CID 95718493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).