C21H22N2O3 — CID 95718493
(3S)-1'-(2-ethoxybenzoyl)spiro[1H-indole-3,3'-piperidine]-2-one (PubChem CID 95718493) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is (3S)-1'-(2-ethoxybenzoyl)spiro[1H-indole-3,3'-piperidine]-2-one.
| Compound Name | (3S)-1'-(2-ethoxybenzoyl)spiro[1H-indole-3,3'-piperidine]-2-one |
|---|---|
| PubChem CID | 95718493 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | (3S)-1'-(2-ethoxybenzoyl)spiro[1H-indole-3,3'-piperidine]-2-one |
| SMILES | CCOc1ccccc1C(=O)N1CCC[C@]2(C1)C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C21H22N2O3/c1-2-26-18-11-6-3-8-15(18)19(24)23-13-7-12-21(14-23)16-9-4-5-10-17(16)22-20(21)25/h3-6,8-11H,2,7,12-14H2,1H3,(H,22,25)/t21-/m1/s1 |
| InChIKey | ZNTATNJKWZNVCV-OAQYLSRUSA-N |
| XLogP | 3.21 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |