C20H20N2O4 — CID 53176938
1'-(2,4-dimethoxybenzoyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one (PubChem CID 53176938) has the molecular formula C20H20N2O4 and a molecular weight of 352.39 g/mol. Its IUPAC name is 1'-(2,4-dimethoxybenzoyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one.
| Compound Name | 1'-(2,4-dimethoxybenzoyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one |
|---|---|
| PubChem CID | 53176938 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 1'-(2,4-dimethoxybenzoyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one |
| SMILES | COc1ccc(C(=O)N2CCC3(C2)C(=O)Nc2ccccc23)c(OC)c1 |
| InChI | InChI=1S/C20H20N2O4/c1-25-13-7-8-14(17(11-13)26-2)18(23)22-10-9-20(12-22)15-5-3-4-6-16(15)21-19(20)24/h3-8,11H,9-10,12H2,1-2H3,(H,21,24) |
| InChIKey | OKFQHUNYAYDXCS-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |