C16H19N3O4 — CID 47017588
8-(2-ethoxybenzoyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 47017588) has the molecular formula C16H19N3O4 and a molecular weight of 317.35 g/mol. Its IUPAC name is 8-(2-ethoxybenzoyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-(2-ethoxybenzoyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 47017588 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 8-(2-ethoxybenzoyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CCOc1ccccc1C(=O)N1CCC2(CC1)NC(=O)NC2=O |
| InChI | InChI=1S/C16H19N3O4/c1-2-23-12-6-4-3-5-11(12)13(20)19-9-7-16(8-10-19)14(21)17-15(22)18-16/h3-6H,2,7-10H2,1H3,(H2,17,18,21,22) |
| InChIKey | BBPVZMFTIQQDOG-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|