About (3R)-1'-(4-methylsulfonylbenzoyl)spiro[1H-indole-3,3'-piperidine]-2-one
(3R)-1'-(4-methylsulfonylbenzoyl)spiro[1H-indole-3,3'-piperidine]-2-one (PubChem CID 95716797) has the molecular formula C20H20N2O4S
and a molecular weight of 384.46 g/mol. Its IUPAC name is (3R)-1'-(4-methylsulfonylbenzoyl)spiro[1H-indole-3,3'-piperidine]-2-one.
Molecular Properties
| Compound Name | (3R)-1'-(4-methylsulfonylbenzoyl)spiro[1H-indole-3,3'-piperidine]-2-one |
| PubChem CID | 95716797 |
| Molecular Formula | C20H20N2O4S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | (3R)-1'-(4-methylsulfonylbenzoyl)spiro[1H-indole-3,3'-piperidine]-2-one |
| SMILES | CS(=O)(=O)c1ccc(C(=O)N2CCC[C@@]3(C2)C(=O)Nc2ccccc23)cc1 |
| InChI | InChI=1S/C20H20N2O4S/c1-27(25,26)15-9-7-14(8-10-15)18(23)22-12-4-11-20(13-22)16-5-2-3-6-17(16)21-19(20)24/h2-3,5-10H,4,11-13H2,1H3,(H,21,24)/t20-/m0/s1 |
| InChIKey | GGRWZRRDSLELAM-FQEVSTJZSA-N |
| XLogP | 2.22 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3R)-1'-(4-methylsulfonylbenzoyl)spiro[1H-indole-3,3'-piperidine]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-1'-(4-methylsulfonylbenzoyl)spiro[1H-indole-3,3'-piperidine]-2-one?
The IUPAC name of (3R)-1'-(4-methylsulfonylbenzoyl)spiro[1H-indole-3,3'-piperidine]-2-one (CID 95716797) is (3R)-1'-(4-methylsulfonylbenzoyl)spiro[1H-indole-3,3'-piperidine]-2-one.
What is the SMILES notation for (3R)-1'-(4-methylsulfonylbenzoyl)spiro[1H-indole-3,3'-piperidine]-2-one?
The canonical SMILES for (3R)-1'-(4-methylsulfonylbenzoyl)spiro[1H-indole-3,3'-piperidine]-2-one is CS(=O)(=O)c1ccc(C(=O)N2CCC[C@@]3(C2)C(=O)Nc2ccccc23)cc1.
What is the InChIKey of (3R)-1'-(4-methylsulfonylbenzoyl)spiro[1H-indole-3,3'-piperidine]-2-one?
The InChIKey is GGRWZRRDSLELAM-FQEVSTJZSA-N. The full InChI is InChI=1S/C20H20N2O4S/c1-27(25,26)15-9-7-14(8-10-15)18(23)22-12-4-11-20(13-22)16-5-2-3-6-17(16)21-19(20)24/h2-3,5-10H,4,11-13H2,1H3,(H,21,24)/t20-/m0/s1.
What are the key properties of (3R)-1'-(4-methylsulfonylbenzoyl)spiro[1H-indole-3,3'-piperidine]-2-one?
(3R)-1'-(4-methylsulfonylbenzoyl)spiro[1H-indole-3,3'-piperidine]-2-one has a molecular weight of 384.46 g/mol, XLogP of 2.22, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-1'-(4-methylsulfonylbenzoyl)spiro[1H-indole-3,3'-piperidine]-2-one is sourced from PubChem (CID 95716797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).