C16H20N2O3 — CID 95718964
(3R)-1'-(2-ethoxyacetyl)spiro[1H-indole-3,3'-piperidine]-2-one (PubChem CID 95718964) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is (3R)-1'-(2-ethoxyacetyl)spiro[1H-indole-3,3'-piperidine]-2-one.
| Compound Name | (3R)-1'-(2-ethoxyacetyl)spiro[1H-indole-3,3'-piperidine]-2-one |
|---|---|
| PubChem CID | 95718964 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | (3R)-1'-(2-ethoxyacetyl)spiro[1H-indole-3,3'-piperidine]-2-one |
| SMILES | CCOCC(=O)N1CCC[C@@]2(C1)C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C16H20N2O3/c1-2-21-10-14(19)18-9-5-8-16(11-18)12-6-3-4-7-13(12)17-15(16)20/h3-4,6-7H,2,5,8-11H2,1H3,(H,17,20)/t16-/m0/s1 |
| InChIKey | JFMAIEGTWDDITQ-INIZCTEOSA-N |
| XLogP | 1.54 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |