C21H20N2O4 — CID 56917233
1'-[2-(1,3-benzodioxol-5-yl)acetyl]spiro[1H-indole-3,3'-piperidine]-2-one (PubChem CID 56917233) has the molecular formula C21H20N2O4 and a molecular weight of 364.40 g/mol. Its IUPAC name is 1'-[2-(1,3-benzodioxol-5-yl)acetyl]spiro[1H-indole-3,3'-piperidine]-2-one.
| Compound Name | 1'-[2-(1,3-benzodioxol-5-yl)acetyl]spiro[1H-indole-3,3'-piperidine]-2-one |
|---|---|
| PubChem CID | 56917233 |
| Molecular Formula | C21H20N2O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 1'-[2-(1,3-benzodioxol-5-yl)acetyl]spiro[1H-indole-3,3'-piperidine]-2-one |
| SMILES | O=C(Cc1ccc2c(c1)OCO2)N1CCCC2(C1)C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C21H20N2O4/c24-19(11-14-6-7-17-18(10-14)27-13-26-17)23-9-3-8-21(12-23)15-4-1-2-5-16(15)22-20(21)25/h1-2,4-7,10H,3,8-9,11-13H2,(H,22,25) |
| InChIKey | NQTUQDTZKSCXDW-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |