C14H19N3O3S — CID 95707296
(3R)-N,N-dimethyl-2-oxospiro[1H-indole-3,3'-piperidine]-1'-sulfonamide (PubChem CID 95707296) has the molecular formula C14H19N3O3S and a molecular weight of 309.39 g/mol. Its IUPAC name is (3R)-N,N-dimethyl-2-oxospiro[1H-indole-3,3'-piperidine]-1'-sulfonamide.
| Compound Name | (3R)-N,N-dimethyl-2-oxospiro[1H-indole-3,3'-piperidine]-1'-sulfonamide |
|---|---|
| PubChem CID | 95707296 |
| Molecular Formula | C14H19N3O3S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | (3R)-N,N-dimethyl-2-oxospiro[1H-indole-3,3'-piperidine]-1'-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCC[C@@]2(C1)C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C14H19N3O3S/c1-16(2)21(19,20)17-9-5-8-14(10-17)11-6-3-4-7-12(11)15-13(14)18/h3-4,6-7H,5,8-10H2,1-2H3,(H,15,18)/t14-/m0/s1 |
| InChIKey | GUAQIWDPFHPKKW-AWEZNQCLSA-N |
| XLogP | 0.78 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |