C19H16ClFN2O2 — CID 56904113
1'-(2-chloro-4-fluorobenzoyl)spiro[1H-indole-3,3'-piperidine]-2-one (PubChem CID 56904113) has the molecular formula C19H16ClFN2O2 and a molecular weight of 358.80 g/mol. Its IUPAC name is 1'-(2-chloro-4-fluorobenzoyl)spiro[1H-indole-3,3'-piperidine]-2-one.
| Compound Name | 1'-(2-chloro-4-fluorobenzoyl)spiro[1H-indole-3,3'-piperidine]-2-one |
|---|---|
| PubChem CID | 56904113 |
| Molecular Formula | C19H16ClFN2O2 |
| Molecular Weight | 358.80 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | 1'-(2-chloro-4-fluorobenzoyl)spiro[1H-indole-3,3'-piperidine]-2-one |
| SMILES | O=C(c1ccc(F)cc1Cl)N1CCCC2(C1)C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C19H16ClFN2O2/c20-15-10-12(21)6-7-13(15)17(24)23-9-3-8-19(11-23)14-4-1-2-5-16(14)22-18(19)25/h1-2,4-7,10H,3,8-9,11H2,(H,22,25) |
| InChIKey | SZSVOEULDXEUJX-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.80 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |