C29H27N5O — CID 55720784
4-[4-(1-benzyl-3-phenylpyrazole-4-carbonyl)-1,4-diazepan-1-yl]benzonitrile (PubChem CID 55720784) has the molecular formula C29H27N5O and a molecular weight of 461.57 g/mol. Its IUPAC name is 4-[4-(1-benzyl-3-phenylpyrazole-4-carbonyl)-1,4-diazepan-1-yl]benzonitrile.
| Compound Name | 4-[4-(1-benzyl-3-phenylpyrazole-4-carbonyl)-1,4-diazepan-1-yl]benzonitrile |
|---|---|
| PubChem CID | 55720784 |
| Molecular Formula | C29H27N5O |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | 4-[4-(1-benzyl-3-phenylpyrazole-4-carbonyl)-1,4-diazepan-1-yl]benzonitrile |
| SMILES | N#Cc1ccc(N2CCCN(C(=O)c3cn(Cc4ccccc4)nc3-c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C29H27N5O/c30-20-23-12-14-26(15-13-23)32-16-7-17-33(19-18-32)29(35)27-22-34(21-24-8-3-1-4-9-24)31-28(27)25-10-5-2-6-11-25/h1-6,8-15,22H,7,16-19,21H2 |
| InChIKey | GDEIUAJODOXUDK-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 65.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |