C23H26N4O2 — CID 119416124
[1-benzyl-3-(3-methoxyphenyl)pyrazol-4-yl]-(1,4-diazepan-1-yl)methanone (PubChem CID 119416124) has the molecular formula C23H26N4O2 and a molecular weight of 390.49 g/mol. Its IUPAC name is [1-benzyl-3-(3-methoxyphenyl)pyrazol-4-yl]-(1,4-diazepan-1-yl)methanone.
| Compound Name | [1-benzyl-3-(3-methoxyphenyl)pyrazol-4-yl]-(1,4-diazepan-1-yl)methanone |
|---|---|
| PubChem CID | 119416124 |
| Molecular Formula | C23H26N4O2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | [1-benzyl-3-(3-methoxyphenyl)pyrazol-4-yl]-(1,4-diazepan-1-yl)methanone |
| SMILES | COc1cccc(-c2nn(Cc3ccccc3)cc2C(=O)N2CCCNCC2)c1 |
| InChI | InChI=1S/C23H26N4O2/c1-29-20-10-5-9-19(15-20)22-21(23(28)26-13-6-11-24-12-14-26)17-27(25-22)16-18-7-3-2-4-8-18/h2-5,7-10,15,17,24H,6,11-14,16H2,1H3 |
| InChIKey | QOFZDQHMGSAOJR-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |