C27H27N5O2 — CID 31566098
[1-benzyl-3-(3-methoxyphenyl)pyrazol-4-yl]-(4-pyridin-4-ylpiperazin-1-yl)methanone (PubChem CID 31566098) has the molecular formula C27H27N5O2 and a molecular weight of 453.55 g/mol. Its IUPAC name is [1-benzyl-3-(3-methoxyphenyl)pyrazol-4-yl]-(4-pyridin-4-ylpiperazin-1-yl)methanone.
| Compound Name | [1-benzyl-3-(3-methoxyphenyl)pyrazol-4-yl]-(4-pyridin-4-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 31566098 |
| Molecular Formula | C27H27N5O2 |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | [1-benzyl-3-(3-methoxyphenyl)pyrazol-4-yl]-(4-pyridin-4-ylpiperazin-1-yl)methanone |
| SMILES | COc1cccc(-c2nn(Cc3ccccc3)cc2C(=O)N2CCN(c3ccncc3)CC2)c1 |
| InChI | InChI=1S/C27H27N5O2/c1-34-24-9-5-8-22(18-24)26-25(20-32(29-26)19-21-6-3-2-4-7-21)27(33)31-16-14-30(15-17-31)23-10-12-28-13-11-23/h2-13,18,20H,14-17,19H2,1H3 |
| InChIKey | QSXCLKMUGCZNED-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |