C27H32N4O3 — CID 55368510
[1-benzyl-3-(3-methoxyphenyl)pyrazol-4-yl]-[4-(oxolan-2-ylmethyl)piperazin-1-yl]methanone (PubChem CID 55368510) has the molecular formula C27H32N4O3 and a molecular weight of 460.58 g/mol. Its IUPAC name is [1-benzyl-3-(3-methoxyphenyl)pyrazol-4-yl]-[4-(oxolan-2-ylmethyl)piperazin-1-yl]methanone.
| Compound Name | [1-benzyl-3-(3-methoxyphenyl)pyrazol-4-yl]-[4-(oxolan-2-ylmethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 55368510 |
| Molecular Formula | C27H32N4O3 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | [1-benzyl-3-(3-methoxyphenyl)pyrazol-4-yl]-[4-(oxolan-2-ylmethyl)piperazin-1-yl]methanone |
| SMILES | COc1cccc(-c2nn(Cc3ccccc3)cc2C(=O)N2CCN(CC3CCCO3)CC2)c1 |
| InChI | InChI=1S/C27H32N4O3/c1-33-23-10-5-9-22(17-23)26-25(20-31(28-26)18-21-7-3-2-4-8-21)27(32)30-14-12-29(13-15-30)19-24-11-6-16-34-24/h2-5,7-10,17,20,24H,6,11-16,18-19H2,1H3 |
| InChIKey | PCPNJOKCHJIXLK-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 59.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |