C18H17F2IN2O — CID 87030189
(4-fluoro-2-iodophenyl)-[4-(4-fluorophenyl)-1,4-diazepan-1-yl]methanone (PubChem CID 87030189) has the molecular formula C18H17F2IN2O and a molecular weight of 442.25 g/mol. Its IUPAC name is (4-fluoro-2-iodophenyl)-[4-(4-fluorophenyl)-1,4-diazepan-1-yl]methanone.
| Compound Name | (4-fluoro-2-iodophenyl)-[4-(4-fluorophenyl)-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 87030189 |
| Molecular Formula | C18H17F2IN2O |
| Molecular Weight | 442.25 g/mol |
| Exact Mass | 442.04 |
| IUPAC Name | (4-fluoro-2-iodophenyl)-[4-(4-fluorophenyl)-1,4-diazepan-1-yl]methanone |
| SMILES | O=C(c1ccc(F)cc1I)N1CCCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C18H17F2IN2O/c19-13-2-5-15(6-3-13)22-8-1-9-23(11-10-22)18(24)16-7-4-14(20)12-17(16)21/h2-7,12H,1,8-11H2 |
| InChIKey | YNTSTJYVNFTXEK-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.25 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|