C18H17Cl2FN2O — CID 87029905
(2,3-dichlorophenyl)-[4-(4-fluorophenyl)-1,4-diazepan-1-yl]methanone (PubChem CID 87029905) has the molecular formula C18H17Cl2FN2O and a molecular weight of 367.25 g/mol. Its IUPAC name is (2,3-dichlorophenyl)-[4-(4-fluorophenyl)-1,4-diazepan-1-yl]methanone.
| Compound Name | (2,3-dichlorophenyl)-[4-(4-fluorophenyl)-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 87029905 |
| Molecular Formula | C18H17Cl2FN2O |
| Molecular Weight | 367.25 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | (2,3-dichlorophenyl)-[4-(4-fluorophenyl)-1,4-diazepan-1-yl]methanone |
| SMILES | O=C(c1cccc(Cl)c1Cl)N1CCCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C18H17Cl2FN2O/c19-16-4-1-3-15(17(16)20)18(24)23-10-2-9-22(11-12-23)14-7-5-13(21)6-8-14/h1,3-8H,2,9-12H2 |
| InChIKey | FUFPDCCKWCEIGF-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.25 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |