C23H33N3O — CID 55716002
4-[4-(4-butylcyclohexanecarbonyl)-1,4-diazepan-1-yl]benzonitrile (PubChem CID 55716002) has the molecular formula C23H33N3O and a molecular weight of 367.54 g/mol. Its IUPAC name is 4-[4-(4-butylcyclohexanecarbonyl)-1,4-diazepan-1-yl]benzonitrile.
| Compound Name | 4-[4-(4-butylcyclohexanecarbonyl)-1,4-diazepan-1-yl]benzonitrile |
|---|---|
| PubChem CID | 55716002 |
| Molecular Formula | C23H33N3O |
| Molecular Weight | 367.54 g/mol |
| Exact Mass | 367.26 |
| IUPAC Name | 4-[4-(4-butylcyclohexanecarbonyl)-1,4-diazepan-1-yl]benzonitrile |
| SMILES | CCCCC1CCC(C(=O)N2CCCN(c3ccc(C#N)cc3)CC2)CC1 |
| InChI | InChI=1S/C23H33N3O/c1-2-3-5-19-6-10-21(11-7-19)23(27)26-15-4-14-25(16-17-26)22-12-8-20(18-24)9-13-22/h8-9,12-13,19,21H,2-7,10-11,14-17H2,1H3 |
| InChIKey | UIBDMZMJDMDAAA-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.54 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |