C24H34N4O — CID 108741197
(4-butylcyclohexyl)-[4-(3-methylquinoxalin-2-yl)piperazin-1-yl]methanone (PubChem CID 108741197) has the molecular formula C24H34N4O and a molecular weight of 394.56 g/mol. Its IUPAC name is (4-butylcyclohexyl)-[4-(3-methylquinoxalin-2-yl)piperazin-1-yl]methanone.
| Compound Name | (4-butylcyclohexyl)-[4-(3-methylquinoxalin-2-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 108741197 |
| Molecular Formula | C24H34N4O |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | (4-butylcyclohexyl)-[4-(3-methylquinoxalin-2-yl)piperazin-1-yl]methanone |
| SMILES | CCCCC1CCC(C(=O)N2CCN(c3nc4ccccc4nc3C)CC2)CC1 |
| InChI | InChI=1S/C24H34N4O/c1-3-4-7-19-10-12-20(13-11-19)24(29)28-16-14-27(15-17-28)23-18(2)25-21-8-5-6-9-22(21)26-23/h5-6,8-9,19-20H,3-4,7,10-17H2,1-2H3 |
| InChIKey | NBHUXCLHPVOVFD-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |