C28H34FN5O5 — CID 70804157
2-(fluoromethyl)-4-[[4-[2-[4-(3-methoxy-4-nitroanilino)piperidin-1-yl]-2-oxoethoxy]cyclohexyl]amino]benzonitrile (PubChem CID 70804157) has the molecular formula C28H34FN5O5 and a molecular weight of 539.61 g/mol. Its IUPAC name is 2-(fluoromethyl)-4-[[4-[2-[4-(3-methoxy-4-nitroanilino)piperidin-1-yl]-2-oxoethoxy]cyclohexyl]amino]benzonitrile.
| Compound Name | 2-(fluoromethyl)-4-[[4-[2-[4-(3-methoxy-4-nitroanilino)piperidin-1-yl]-2-oxoethoxy]cyclohexyl]amino]benzonitrile |
|---|---|
| PubChem CID | 70804157 |
| Molecular Formula | C28H34FN5O5 |
| Molecular Weight | 539.61 g/mol |
| Exact Mass | 539.25 |
| IUPAC Name | 2-(fluoromethyl)-4-[[4-[2-[4-(3-methoxy-4-nitroanilino)piperidin-1-yl]-2-oxoethoxy]cyclohexyl]amino]benzonitrile |
| SMILES | COc1cc(NC2CCN(C(=O)COC3CCC(Nc4ccc(C#N)c(CF)c4)CC3)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C28H34FN5O5/c1-38-27-15-24(6-9-26(27)34(36)37)32-22-10-12-33(13-11-22)28(35)18-39-25-7-4-21(5-8-25)31-23-3-2-19(17-30)20(14-23)16-29/h2-3,6,9,14-15,21-22,25,31-32H,4-5,7-8,10-13,16,18H2,1H3 |
| InChIKey | MUWKIWGMFWOVLE-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 129.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.61 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|