C28H33F3N6O2 — CID 144994150
4-[[1-[2-[4-[4-cyano-3-(trifluoromethyl)anilino]cyclohexyl]oxyacetyl]piperidin-4-yl]amino]benzenecarboximidamide (PubChem CID 144994150) has the molecular formula C28H33F3N6O2 and a molecular weight of 542.61 g/mol. Its IUPAC name is 4-[[1-[2-[4-[4-cyano-3-(trifluoromethyl)anilino]cyclohexyl]oxyacetyl]piperidin-4-yl]amino]benzenecarboximidamide.
| Compound Name | 4-[[1-[2-[4-[4-cyano-3-(trifluoromethyl)anilino]cyclohexyl]oxyacetyl]piperidin-4-yl]amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 144994150 |
| Molecular Formula | C28H33F3N6O2 |
| Molecular Weight | 542.61 g/mol |
| Exact Mass | 542.26 |
| IUPAC Name | 4-[[1-[2-[4-[4-cyano-3-(trifluoromethyl)anilino]cyclohexyl]oxyacetyl]piperidin-4-yl]amino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(NC2CCN(C(=O)COC3CCC(Nc4ccc(C#N)c(C(F)(F)F)c4)CC3)CC2)cc1 |
| InChI | InChI=1S/C28H33F3N6O2/c29-28(30,31)25-15-23(6-3-19(25)16-32)36-21-7-9-24(10-8-21)39-17-26(38)37-13-11-22(12-14-37)35-20-4-1-18(2-5-20)27(33)34/h1-6,15,21-22,24,35-36H,7-14,17H2,(H3,33,34) |
| InChIKey | OPXWUSCTKMZJIQ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 127.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.61 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|